C13H17BrClF3N2O2 — CID 171181082
4-bromo-2-methoxy-6-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride (PubChem CID 171181082) has the molecular formula C13H17BrClF3N2O2 and a molecular weight of 405.64 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride.
| Compound Name | 4-bromo-2-methoxy-6-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171181082 |
| Molecular Formula | C13H17BrClF3N2O2 |
| Molecular Weight | 405.64 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 4-bromo-2-methoxy-6-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;hydrochloride |
| SMILES | COc1cc(Br)cc([C@@H](N2CCNCC2)C(F)(F)F)c1O.Cl |
| InChI | InChI=1S/C13H16BrF3N2O2.ClH/c1-21-10-7-8(14)6-9(11(10)20)12(13(15,16)17)19-4-2-18-3-5-19;/h6-7,12,18,20H,2-5H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | ZDOTZIDBROEZHL-UTONKHPSSA-N |
| XLogP | 3.09 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|