C15H22Cl2F3N3O4 — CID 171304163
2-methoxy-4-nitro-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride (PubChem CID 171304163) has the molecular formula C15H22Cl2F3N3O4 and a molecular weight of 436.26 g/mol. Its IUPAC name is 2-methoxy-4-nitro-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride.
| Compound Name | 2-methoxy-4-nitro-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171304163 |
| Molecular Formula | C15H22Cl2F3N3O4 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-methoxy-4-nitro-6-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
| SMILES | COc1cc([N+](=O)[O-])cc([C@@H](CCC(F)(F)F)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C15H20F3N3O4.2ClH/c1-25-13-9-10(21(23)24)8-11(14(13)22)12(2-3-15(16,17)18)20-6-4-19-5-7-20;;/h8-9,12,19,22H,2-7H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | SVUOBPOEVYOEFO-CURYUGHLSA-N |
| XLogP | 3.44 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|