C13H17F2N3O4 — CID 171284161
2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-methoxy-4-nitrophenol (PubChem CID 171284161) has the molecular formula C13H17F2N3O4 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-methoxy-4-nitrophenol.
| Compound Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-methoxy-4-nitrophenol |
|---|---|
| PubChem CID | 171284161 |
| Molecular Formula | C13H17F2N3O4 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-methoxy-4-nitrophenol |
| SMILES | COc1cc([N+](=O)[O-])cc([C@H](C(F)F)N2CCNCC2)c1O |
| InChI | InChI=1S/C13H17F2N3O4/c1-22-10-7-8(18(20)21)6-9(12(10)19)11(13(14)15)17-4-2-16-3-5-17/h6-7,11,13,16,19H,2-5H2,1H3/t11-/m1/s1 |
| InChIKey | RPZMJVWGYRJCEZ-LLVKDONJSA-N |
| XLogP | 1.52 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|