C13H19Cl2F3N2O2 — CID 171299723
2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-fluoro-6-methoxyphenol;dihydrochloride (PubChem CID 171299723) has the molecular formula C13H19Cl2F3N2O2 and a molecular weight of 363.21 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-fluoro-6-methoxyphenol;dihydrochloride.
| Compound Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-fluoro-6-methoxyphenol;dihydrochloride |
|---|---|
| PubChem CID | 171299723 |
| Molecular Formula | C13H19Cl2F3N2O2 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-fluoro-6-methoxyphenol;dihydrochloride |
| SMILES | COc1cc(F)cc([C@H](C(F)F)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C13H17F3N2O2.2ClH/c1-20-10-7-8(14)6-9(12(10)19)11(13(15)16)18-4-2-17-3-5-18;;/h6-7,11,13,17,19H,2-5H2,1H3;2*1H/t11-;;/m1../s1 |
| InChIKey | JDPNDUNZECYFDU-NVJADKKVSA-N |
| XLogP | 2.59 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|