C12H15F2N3O3 — CID 171278432
3-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-nitrophenol (PubChem CID 171278432) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 3-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-nitrophenol.
| Compound Name | 3-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 171278432 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)cc1[C@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C12H15F2N3O3/c13-12(14)11(16-5-3-15-4-6-16)9-7-8(18)1-2-10(9)17(19)20/h1-2,7,11-12,15,18H,3-6H2/t11-/m1/s1 |
| InChIKey | CAHQSYMRJCJVIH-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|