C13H17F2N3O2 — CID 171278765
1-[(1R)-2,2-difluoro-1-(4-methyl-3-nitrophenyl)ethyl]piperazine (PubChem CID 171278765) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluoro-1-(4-methyl-3-nitrophenyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-2,2-difluoro-1-(4-methyl-3-nitrophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171278765 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[(1R)-2,2-difluoro-1-(4-methyl-3-nitrophenyl)ethyl]piperazine |
| SMILES | Cc1ccc([C@H](C(F)F)N2CCNCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17F2N3O2/c1-9-2-3-10(8-11(9)18(19)20)12(13(14)15)17-6-4-16-5-7-17/h2-3,8,12-13,16H,4-7H2,1H3/t12-/m1/s1 |
| InChIKey | NCOCYWVUSWRPSG-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|