C16H21Cl2N3O2S — CID 171291404
1-[(S)-(4-methyl-3-nitrophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171291404) has the molecular formula C16H21Cl2N3O2S and a molecular weight of 390.34 g/mol. Its IUPAC name is 1-[(S)-(4-methyl-3-nitrophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(4-methyl-3-nitrophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171291404 |
| Molecular Formula | C16H21Cl2N3O2S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 1-[(S)-(4-methyl-3-nitrophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@@H](c2cccs2)N2CCNCC2)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C16H19N3O2S.2ClH/c1-12-4-5-13(11-14(12)19(20)21)16(15-3-2-10-22-15)18-8-6-17-7-9-18;;/h2-5,10-11,16-17H,6-9H2,1H3;2*1H/t16-;;/m0../s1 |
| InChIKey | GPVMGWYAJRWFHF-SQKCAUCHSA-N |
| XLogP | 3.80 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|