C17H27Cl2N3O2 — CID 171278775
1-[(S)-cyclopentyl-(4-methyl-3-nitrophenyl)methyl]piperazine;dihydrochloride (PubChem CID 171278775) has the molecular formula C17H27Cl2N3O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(4-methyl-3-nitrophenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopentyl-(4-methyl-3-nitrophenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278775 |
| Molecular Formula | C17H27Cl2N3O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 1-[(S)-cyclopentyl-(4-methyl-3-nitrophenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@H](C2CCCC2)N2CCNCC2)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C17H25N3O2.2ClH/c1-13-6-7-15(12-16(13)20(21)22)17(14-4-2-3-5-14)19-10-8-18-9-11-19;;/h6-7,12,14,17-18H,2-5,8-11H2,1H3;2*1H/t17-;;/m0../s1 |
| InChIKey | YMCVPKMLNRMBKW-RMRYJAPISA-N |
| XLogP | 3.88 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|