C17H25N3O4 — CID 171288642
1-[(R)-(4-methoxy-3-nitrophenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171288642) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[(R)-(4-methoxy-3-nitrophenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(4-methoxy-3-nitrophenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171288642 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[(R)-(4-methoxy-3-nitrophenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | COc1ccc([C@@H](C2CCOCC2)N2CCNCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O4/c1-23-16-3-2-14(12-15(16)20(21)22)17(13-4-10-24-11-5-13)19-8-6-18-7-9-19/h2-3,12-13,17-18H,4-11H2,1H3/t17-/m1/s1 |
| InChIKey | XRCXEQJARHXEND-QGZVFWFLSA-N |
| XLogP | 1.98 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|