C13H18Cl2F3N3O3 — CID 171288626
1-[(1S)-2,2,2-trifluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171288626) has the molecular formula C13H18Cl2F3N3O3 and a molecular weight of 392.21 g/mol. Its IUPAC name is 1-[(1S)-2,2,2-trifluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2,2,2-trifluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288626 |
| Molecular Formula | C13H18Cl2F3N3O3 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 1-[(1S)-2,2,2-trifluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@H](N2CCNCC2)C(F)(F)F)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C13H16F3N3O3.2ClH/c1-22-11-3-2-9(8-10(11)19(20)21)12(13(14,15)16)18-6-4-17-5-7-18;;/h2-3,8,12,17H,4-7H2,1H3;2*1H/t12-;;/m0../s1 |
| InChIKey | LKLNMYSYSBLHRZ-LTCKWSDVSA-N |
| XLogP | 2.96 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|