C12H16Cl2F3N3O3 — CID 171273883
2-nitro-4-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride (PubChem CID 171273883) has the molecular formula C12H16Cl2F3N3O3 and a molecular weight of 378.18 g/mol. Its IUPAC name is 2-nitro-4-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride.
| Compound Name | 2-nitro-4-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171273883 |
| Molecular Formula | C12H16Cl2F3N3O3 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-nitro-4-[(1R)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc([C@@H](N2CCNCC2)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C12H14F3N3O3.2ClH/c13-12(14,15)11(17-5-3-16-4-6-17)8-1-2-10(19)9(7-8)18(20)21;;/h1-2,7,11,16,19H,3-6H2;2*1H/t11-;;/m1../s1 |
| InChIKey | BDPYBEKKLAFXBC-NVJADKKVSA-N |
| XLogP | 2.65 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|