C16H25N3O3 — CID 171190109
(3S)-2,2-dimethyl-3-(4-methyl-3-nitrophenyl)-3-piperazin-1-ylpropan-1-ol (PubChem CID 171190109) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-(4-methyl-3-nitrophenyl)-3-piperazin-1-ylpropan-1-ol.
| Compound Name | (3S)-2,2-dimethyl-3-(4-methyl-3-nitrophenyl)-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 171190109 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3S)-2,2-dimethyl-3-(4-methyl-3-nitrophenyl)-3-piperazin-1-ylpropan-1-ol |
| SMILES | Cc1ccc([C@H](N2CCNCC2)C(C)(C)CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O3/c1-12-4-5-13(10-14(12)19(21)22)15(16(2,3)11-20)18-8-6-17-7-9-18/h4-5,10,15,17,20H,6-9,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | IYAMPQRXQRDJQP-HNNXBMFYSA-N |
| XLogP | 1.87 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|