C12H15Cl2F4N3O2 — CID 171290765
1-[(1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171290765) has the molecular formula C12H15Cl2F4N3O2 and a molecular weight of 380.17 g/mol. Its IUPAC name is 1-[(1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290765 |
| Molecular Formula | C12H15Cl2F4N3O2 |
| Molecular Weight | 380.17 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 1-[(1S)-2,2,2-trifluoro-1-(5-fluoro-2-nitrophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc(F)cc1[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H13F4N3O2.2ClH/c13-8-1-2-10(19(20)21)9(7-8)11(12(14,15)16)18-5-3-17-4-6-18;;/h1-2,7,11,17H,3-6H2;2*1H/t11-;;/m0../s1 |
| InChIKey | JAFBSJATIAXDFA-IDMXKUIJSA-N |
| XLogP | 3.09 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|