C13H16Cl2F3N3O4 — CID 171279559
1-[(1R)-2,2,2-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]piperazine;dihydrochloride (PubChem CID 171279559) has the molecular formula C13H16Cl2F3N3O4 and a molecular weight of 406.19 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279559 |
| Molecular Formula | C13H16Cl2F3N3O4 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(6-nitro-1,3-benzodioxol-5-yl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc2c(cc1[C@@H](N1CCNCC1)C(F)(F)F)OCO2 |
| InChI | InChI=1S/C13H14F3N3O4.2ClH/c14-13(15,16)12(18-3-1-17-2-4-18)8-5-10-11(23-7-22-10)6-9(8)19(20)21;;/h5-6,12,17H,1-4,7H2;2*1H/t12-;;/m1../s1 |
| InChIKey | GHOVNDLXHCZJRF-CURYUGHLSA-N |
| XLogP | 2.68 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|