C14H16N4O4 — CID 171306178
(3S)-3-(6-nitro-1,3-benzodioxol-5-yl)-3-piperazin-1-ylpropanenitrile (PubChem CID 171306178) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (3S)-3-(6-nitro-1,3-benzodioxol-5-yl)-3-piperazin-1-ylpropanenitrile.
| Compound Name | (3S)-3-(6-nitro-1,3-benzodioxol-5-yl)-3-piperazin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 171306178 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3S)-3-(6-nitro-1,3-benzodioxol-5-yl)-3-piperazin-1-ylpropanenitrile |
| SMILES | N#CC[C@@H](c1cc2c(cc1[N+](=O)[O-])OCO2)N1CCNCC1 |
| InChI | InChI=1S/C14H16N4O4/c15-2-1-11(17-5-3-16-4-6-17)10-7-13-14(22-9-21-13)8-12(10)18(19)20/h7-8,11,16H,1,3-6,9H2/t11-/m0/s1 |
| InChIKey | RQFWOVSKKYZGPS-NSHDSACASA-N |
| XLogP | 1.18 |
| TPSA | 100.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|