C17H23N3O4 — CID 171292192
1-[(R)-cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine (PubChem CID 171292192) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171292192 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-[(R)-cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine |
| SMILES | O=[N+]([O-])c1cc2c(cc1[C@@H](C1CCCC1)N1CCNCC1)OCO2 |
| InChI | InChI=1S/C17H23N3O4/c21-20(22)14-10-16-15(23-11-24-16)9-13(14)17(12-3-1-2-4-12)19-7-5-18-6-8-19/h9-10,12,17-18H,1-8,11H2/t17-/m1/s1 |
| InChIKey | XYMMOQDACVYTHR-QGZVFWFLSA-N |
| XLogP | 2.46 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|