C16H23N3O4 — CID 171274218
5-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-nitrobenzene-1,2-diol (PubChem CID 171274218) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 171274218 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 5-[(S)-cyclopentyl(piperazin-1-yl)methyl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc([C@H](C2CCCC2)N2CCNCC2)cc(O)c1O |
| InChI | InChI=1S/C16H23N3O4/c20-14-10-12(9-13(16(14)21)19(22)23)15(11-3-1-2-4-11)18-7-5-17-6-8-18/h9-11,15,17,20-21H,1-8H2/t15-/m0/s1 |
| InChIKey | QVDGBOSPSOGNPJ-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|