C15H21Cl2N3O4 — CID 171279567
1-[(S)-cyclopropyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride (PubChem CID 171279567) has the molecular formula C15H21Cl2N3O4 and a molecular weight of 378.26 g/mol. Its IUPAC name is 1-[(S)-cyclopropyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopropyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279567 |
| Molecular Formula | C15H21Cl2N3O4 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-[(S)-cyclopropyl-(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc2c(cc1[C@H](C1CC1)N1CCNCC1)OCO2 |
| InChI | InChI=1S/C15H19N3O4.2ClH/c19-18(20)12-8-14-13(21-9-22-14)7-11(12)15(10-1-2-10)17-5-3-16-4-6-17;;/h7-8,10,15-16H,1-6,9H2;2*1H/t15-;;/m0../s1 |
| InChIKey | OBKBBDJBNSKTAK-CKUXDGONSA-N |
| XLogP | 2.52 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|