C16H24Cl3N3O3 — CID 171291034
1-[(R)-(5-chloro-2-nitrophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171291034) has the molecular formula C16H24Cl3N3O3 and a molecular weight of 412.75 g/mol. Its IUPAC name is 1-[(R)-(5-chloro-2-nitrophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(5-chloro-2-nitrophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171291034 |
| Molecular Formula | C16H24Cl3N3O3 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-[(R)-(5-chloro-2-nitrophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc(Cl)cc1[C@@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H22ClN3O3.2ClH/c17-13-1-2-15(20(21)22)14(11-13)16(12-3-9-23-10-4-12)19-7-5-18-6-8-19;;/h1-2,11-12,16,18H,3-10H2;2*1H/t16-;;/m1../s1 |
| InChIKey | WKFVINKUENMWNB-GGMCWBHBSA-N |
| XLogP | 3.46 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|