C16H24Cl3FN2O — CID 171275464
1-[(S)-(5-chloro-2-fluorophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171275464) has the molecular formula C16H24Cl3FN2O and a molecular weight of 385.74 g/mol. Its IUPAC name is 1-[(S)-(5-chloro-2-fluorophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(5-chloro-2-fluorophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171275464 |
| Molecular Formula | C16H24Cl3FN2O |
| Molecular Weight | 385.74 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[(S)-(5-chloro-2-fluorophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(Cl)cc1[C@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H22ClFN2O.2ClH/c17-13-1-2-15(18)14(11-13)16(12-3-9-21-10-4-12)20-7-5-19-6-8-20;;/h1-2,11-12,16,19H,3-10H2;2*1H/t16-;;/m0../s1 |
| InChIKey | DFGKFOJQVNIQGS-SQKCAUCHSA-N |
| XLogP | 3.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.74 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |