C16H22FIN2O — CID 171296698
1-[(R)-(2-fluoro-5-iodophenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171296698) has the molecular formula C16H22FIN2O and a molecular weight of 404.27 g/mol. Its IUPAC name is 1-[(R)-(2-fluoro-5-iodophenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(2-fluoro-5-iodophenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171296698 |
| Molecular Formula | C16H22FIN2O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 1-[(R)-(2-fluoro-5-iodophenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | Fc1ccc(I)cc1[C@@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H22FIN2O/c17-15-2-1-13(18)11-14(15)16(12-3-9-21-10-4-12)20-7-5-19-6-8-20/h1-2,11-12,16,19H,3-10H2/t16-/m1/s1 |
| InChIKey | WIQZBLCGVZBQRV-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|