C16H25Cl2IN2O — CID 171293298
1-[(R)-(2-iodophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171293298) has the molecular formula C16H25Cl2IN2O and a molecular weight of 459.20 g/mol. Its IUPAC name is 1-[(R)-(2-iodophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(2-iodophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171293298 |
| Molecular Formula | C16H25Cl2IN2O |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 1-[(R)-(2-iodophenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Ic1ccccc1[C@@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H23IN2O.2ClH/c17-15-4-2-1-3-14(15)16(13-5-11-20-12-6-13)19-9-7-18-8-10-19;;/h1-4,13,16,18H,5-12H2;2*1H/t16-;;/m1../s1 |
| InChIKey | MMGROUIXIHVNCQ-GGMCWBHBSA-N |
| XLogP | 3.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|