C22H29Cl3N2OS — CID 171283412
1-[(S)-[2-(4-chlorophenyl)sulfanylphenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171283412) has the molecular formula C22H29Cl3N2OS and a molecular weight of 475.91 g/mol. Its IUPAC name is 1-[(S)-[2-(4-chlorophenyl)sulfanylphenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-[2-(4-chlorophenyl)sulfanylphenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283412 |
| Molecular Formula | C22H29Cl3N2OS |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-[(S)-[2-(4-chlorophenyl)sulfanylphenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(Sc2ccccc2[C@H](C2CCOCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C22H27ClN2OS.2ClH/c23-18-5-7-19(8-6-18)27-21-4-2-1-3-20(21)22(17-9-15-26-16-10-17)25-13-11-24-12-14-25;;/h1-8,17,22,24H,9-16H2;2*1H/t22-;;/m0../s1 |
| InChIKey | LCAJJPJTTLQHCP-IKXQUJFKSA-N |
| XLogP | 5.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |