C19H23Cl2FN2S — CID 171167494
1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-3-fluoropropyl]piperazine;hydrochloride (PubChem CID 171167494) has the molecular formula C19H23Cl2FN2S and a molecular weight of 401.38 g/mol. Its IUPAC name is 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-3-fluoropropyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-3-fluoropropyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167494 |
| Molecular Formula | C19H23Cl2FN2S |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-3-fluoropropyl]piperazine;hydrochloride |
| SMILES | Cl.FCC[C@@H](c1ccccc1Sc1ccc(Cl)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H22ClFN2S.ClH/c20-15-5-7-16(8-6-15)24-19-4-2-1-3-17(19)18(9-10-21)23-13-11-22-12-14-23;/h1-8,18,22H,9-14H2;1H/t18-;/m0./s1 |
| InChIKey | WNLCAVSOHQTMPP-FERBBOLQSA-N |
| XLogP | 5.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |