C18H20ClFN2S — CID 171182175
1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-2-fluoroethyl]piperazine (PubChem CID 171182175) has the molecular formula C18H20ClFN2S and a molecular weight of 350.89 g/mol. Its IUPAC name is 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-2-fluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-2-fluoroethyl]piperazine |
|---|---|
| PubChem CID | 171182175 |
| Molecular Formula | C18H20ClFN2S |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]-2-fluoroethyl]piperazine |
| SMILES | FC[C@H](c1ccccc1Sc1ccc(Cl)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H20ClFN2S/c19-14-5-7-15(8-6-14)23-18-4-2-1-3-16(18)17(13-20)22-11-9-21-10-12-22/h1-8,17,21H,9-13H2/t17-/m1/s1 |
| InChIKey | TYQCIGYFJWVFGY-QGZVFWFLSA-N |
| XLogP | 4.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |