C20H27Cl3N2S — CID 171283416
1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]butyl]piperazine;dihydrochloride (PubChem CID 171283416) has the molecular formula C20H27Cl3N2S and a molecular weight of 433.88 g/mol. Its IUPAC name is 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283416 |
| Molecular Formula | C20H27Cl3N2S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-[(1S)-1-[2-(4-chlorophenyl)sulfanylphenyl]butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@@H](c1ccccc1Sc1ccc(Cl)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C20H25ClN2S.2ClH/c1-2-5-19(23-14-12-22-13-15-23)18-6-3-4-7-20(18)24-17-10-8-16(21)9-11-17;;/h3-4,6-11,19,22H,2,5,12-15H2,1H3;2*1H/t19-;;/m0../s1 |
| InChIKey | YUBVADQIVOOWLZ-TXEPZDRESA-N |
| XLogP | 6.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |