C19H34Cl2N2S — CID 171308376
1-[(1R)-1-(2-tert-butylsulfanylphenyl)pentyl]piperazine;dihydrochloride (PubChem CID 171308376) has the molecular formula C19H34Cl2N2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[(1R)-1-(2-tert-butylsulfanylphenyl)pentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-tert-butylsulfanylphenyl)pentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308376 |
| Molecular Formula | C19H34Cl2N2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[(1R)-1-(2-tert-butylsulfanylphenyl)pentyl]piperazine;dihydrochloride |
| SMILES | CCCC[C@H](c1ccccc1SC(C)(C)C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H32N2S.2ClH/c1-5-6-10-17(21-14-12-20-13-15-21)16-9-7-8-11-18(16)22-19(2,3)4;;/h7-9,11,17,20H,5-6,10,12-15H2,1-4H3;2*1H/t17-;;/m1../s1 |
| InChIKey | WSALVQYSPQHMTR-ZEECNFPPSA-N |
| XLogP | 5.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |