C16H25Cl2N3 — CID 171307585
2-[(1R)-1-piperazin-1-ylpentyl]benzonitrile;dihydrochloride (PubChem CID 171307585) has the molecular formula C16H25Cl2N3 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-[(1R)-1-piperazin-1-ylpentyl]benzonitrile;dihydrochloride.
| Compound Name | 2-[(1R)-1-piperazin-1-ylpentyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171307585 |
| Molecular Formula | C16H25Cl2N3 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[(1R)-1-piperazin-1-ylpentyl]benzonitrile;dihydrochloride |
| SMILES | CCCC[C@H](c1ccccc1C#N)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H23N3.2ClH/c1-2-3-8-16(19-11-9-18-10-12-19)15-7-5-4-6-14(15)13-17;;/h4-7,16,18H,2-3,8-12H2,1H3;2*1H/t16-;;/m1../s1 |
| InChIKey | NKIUFXPMAMEXAX-GGMCWBHBSA-N |
| XLogP | 3.54 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |