C15H21F3N2OS — CID 171173999
(4R)-4-piperazin-1-yl-4-[2-(trifluoromethylsulfanyl)phenyl]butan-1-ol (PubChem CID 171173999) has the molecular formula C15H21F3N2OS and a molecular weight of 334.41 g/mol. Its IUPAC name is (4R)-4-piperazin-1-yl-4-[2-(trifluoromethylsulfanyl)phenyl]butan-1-ol.
| Compound Name | (4R)-4-piperazin-1-yl-4-[2-(trifluoromethylsulfanyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 171173999 |
| Molecular Formula | C15H21F3N2OS |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (4R)-4-piperazin-1-yl-4-[2-(trifluoromethylsulfanyl)phenyl]butan-1-ol |
| SMILES | OCCC[C@H](c1ccccc1SC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C15H21F3N2OS/c16-15(17,18)22-14-6-2-1-4-12(14)13(5-3-11-21)20-9-7-19-8-10-20/h1-2,4,6,13,19,21H,3,5,7-11H2/t13-/m1/s1 |
| InChIKey | KYEJXDWJMGOSGO-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |