C15H19F3N2S — CID 171167135
1-[(1S)-1-[2-(trifluoromethylsulfanyl)phenyl]but-3-enyl]piperazine (PubChem CID 171167135) has the molecular formula C15H19F3N2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-[(1S)-1-[2-(trifluoromethylsulfanyl)phenyl]but-3-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-(trifluoromethylsulfanyl)phenyl]but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171167135 |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(1S)-1-[2-(trifluoromethylsulfanyl)phenyl]but-3-enyl]piperazine |
| SMILES | C=CC[C@@H](c1ccccc1SC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C15H19F3N2S/c1-2-5-13(20-10-8-19-9-11-20)12-6-3-4-7-14(12)21-15(16,17)18/h2-4,6-7,13,19H,1,5,8-11H2/t13-/m0/s1 |
| InChIKey | QWVDCLIUBNLEOI-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|