C14H21Cl2IN2 — CID 171280664
1-[(1S)-1-(2-iodophenyl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171280664) has the molecular formula C14H21Cl2IN2 and a molecular weight of 415.15 g/mol. Its IUPAC name is 1-[(1S)-1-(2-iodophenyl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-iodophenyl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171280664 |
| Molecular Formula | C14H21Cl2IN2 |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 1-[(1S)-1-(2-iodophenyl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@@H](c1ccccc1I)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H19IN2.2ClH/c1-2-5-14(17-10-8-16-9-11-17)12-6-3-4-7-13(12)15;;/h2-4,6-7,14,16H,1,5,8-11H2;2*1H/t14-;;/m0../s1 |
| InChIKey | DKXOELZXTGBUJS-UTLKBRERSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|