C13H20Cl3N3 — CID 171273130
1-[(1S)-1-(2-chloro-3-pyridinyl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171273130) has the molecular formula C13H20Cl3N3 and a molecular weight of 324.68 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-3-pyridinyl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-chloro-3-pyridinyl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273130 |
| Molecular Formula | C13H20Cl3N3 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-3-pyridinyl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@@H](c1cccnc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H18ClN3.2ClH/c1-2-4-12(17-9-7-15-8-10-17)11-5-3-6-16-13(11)14;;/h2-3,5-6,12,15H,1,4,7-10H2;2*1H/t12-;;/m0../s1 |
| InChIKey | NZWQQPCAFANEIV-LTCKWSDVSA-N |
| XLogP | 3.10 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|