C14H22ClN3 — CID 171273149
1-[(1S)-1-(2-chloro-3-pyridinyl)-3-methylbutyl]piperazine (PubChem CID 171273149) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-3-pyridinyl)-3-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-chloro-3-pyridinyl)-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171273149 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-3-pyridinyl)-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@@H](c1cccnc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C14H22ClN3/c1-11(2)10-13(18-8-6-16-7-9-18)12-4-3-5-17-14(12)15/h3-5,11,13,16H,6-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | HADGNHALFUVMCC-ZDUSSCGKSA-N |
| XLogP | 2.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|