C16H22ClF3N2 — CID 171171550
1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine (PubChem CID 171171550) has the molecular formula C16H22ClF3N2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine.
| Compound Name | 1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171171550 |
| Molecular Formula | C16H22ClF3N2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@H](c1cccc(C(F)(F)F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C16H22ClF3N2/c1-11(2)10-14(22-8-6-21-7-9-22)12-4-3-5-13(15(12)17)16(18,19)20/h3-5,11,14,21H,6-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | FZOMTCQDWGJVJG-CQSZACIVSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |