C13H17Cl3F4N2 — CID 171292669
1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine;dihydrochloride (PubChem CID 171292669) has the molecular formula C13H17Cl3F4N2 and a molecular weight of 383.64 g/mol. Its IUPAC name is 1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292669 |
| Molecular Formula | C13H17Cl3F4N2 |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC[C@H](c1cccc(C(F)(F)F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF4N2.2ClH/c14-12-9(2-1-3-10(12)13(16,17)18)11(8-15)20-6-4-19-5-7-20;;/h1-3,11,19H,4-8H2;2*1H/t11-;;/m1../s1 |
| InChIKey | QLBNUTFUPBFLOQ-NVJADKKVSA-N |
| XLogP | 4.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |