C13H17ClF4N2 — CID 171181940
1-[(1S)-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride (PubChem CID 171181940) has the molecular formula C13H17ClF4N2 and a molecular weight of 312.74 g/mol. Its IUPAC name is 1-[(1S)-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181940 |
| Molecular Formula | C13H17ClF4N2 |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[(1S)-2-fluoro-1-[2-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride |
| SMILES | Cl.FC[C@H](c1ccccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H16F4N2.ClH/c14-9-12(19-7-5-18-6-8-19)10-3-1-2-4-11(10)13(15,16)17;/h1-4,12,18H,5-9H2;1H/t12-;/m1./s1 |
| InChIKey | NCSJZHQVVZVCKL-UTONKHPSSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |