C14H15F7N2 — CID 171182011
1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine (PubChem CID 171182011) has the molecular formula C14H15F7N2 and a molecular weight of 344.27 g/mol. Its IUPAC name is 1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine |
|---|---|
| PubChem CID | 171182011 |
| Molecular Formula | C14H15F7N2 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine |
| SMILES | FC[C@H](c1cc(C(F)(F)F)ccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H15F7N2/c15-8-12(23-5-3-22-4-6-23)10-7-9(13(16,17)18)1-2-11(10)14(19,20)21/h1-2,7,12,22H,3-6,8H2/t12-/m1/s1 |
| InChIKey | KWRVTQABUBVXGM-GFCCVEGCSA-N |
| XLogP | 3.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |