C19H24F6N2 — CID 171166007
1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]hept-6-enyl]piperazine (PubChem CID 171166007) has the molecular formula C19H24F6N2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]hept-6-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]hept-6-enyl]piperazine |
|---|---|
| PubChem CID | 171166007 |
| Molecular Formula | C19H24F6N2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]hept-6-enyl]piperazine |
| SMILES | C=CCCCC[C@@H](c1cc(C(F)(F)F)ccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C19H24F6N2/c1-2-3-4-5-6-17(27-11-9-26-10-12-27)15-13-14(18(20,21)22)7-8-16(15)19(23,24)25/h2,7-8,13,17,26H,1,3-6,9-12H2/t17-/m0/s1 |
| InChIKey | QXZRESBAOMCXIF-KRWDZBQOSA-N |
| XLogP | 5.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|