C15H18BrF3N2 — CID 171165215
1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]but-3-enyl]piperazine (PubChem CID 171165215) has the molecular formula C15H18BrF3N2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]but-3-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171165215 |
| Molecular Formula | C15H18BrF3N2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]but-3-enyl]piperazine |
| SMILES | C=CC[C@@H](c1cc(C(F)(F)F)ccc1Br)N1CCNCC1 |
| InChI | InChI=1S/C15H18BrF3N2/c1-2-3-14(21-8-6-20-7-9-21)12-10-11(15(17,18)19)4-5-13(12)16/h2,4-5,10,14,20H,1,3,6-9H2/t14-/m0/s1 |
| InChIKey | NTCVMKNUTBIAQE-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|