C16H20BrF3N2 — CID 171278983
1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine (PubChem CID 171278983) has the molecular formula C16H20BrF3N2 and a molecular weight of 377.25 g/mol. Its IUPAC name is 1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171278983 |
| Molecular Formula | C16H20BrF3N2 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-[(1S)-1-[2-bromo-5-(trifluoromethyl)phenyl]pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1cc(C(F)(F)F)ccc1Br)N1CCNCC1 |
| InChI | InChI=1S/C16H20BrF3N2/c1-2-3-4-15(22-9-7-21-8-10-22)13-11-12(16(18,19)20)5-6-14(13)17/h2,5-6,11,15,21H,1,3-4,7-10H2/t15-/m0/s1 |
| InChIKey | PGOZWZJPVHLUFG-HNNXBMFYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|