C21H24ClF3N2 — CID 171167114
1-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]but-3-enyl]piperazine;hydrochloride (PubChem CID 171167114) has the molecular formula C21H24ClF3N2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167114 |
| Molecular Formula | C21H24ClF3N2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[(1S)-1-[4-[4-(trifluoromethyl)phenyl]phenyl]but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@@H](c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)N1CCNCC1.Cl |
| InChI | InChI=1S/C21H23F3N2.ClH/c1-2-3-20(26-14-12-25-13-15-26)18-6-4-16(5-7-18)17-8-10-19(11-9-17)21(22,23)24;/h2,4-11,20,25H,1,3,12-15H2;1H/t20-;/m0./s1 |
| InChIKey | QWPSVDAZQGZKCP-BDQAORGHSA-N |
| XLogP | 5.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|