C15H19Cl2F3N2 — CID 171172870
1-[(1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride (PubChem CID 171172870) has the molecular formula C15H19Cl2F3N2 and a molecular weight of 355.23 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172870 |
| Molecular Formula | C15H19Cl2F3N2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-4-(trifluoromethyl)phenyl]but-3-enyl]piperazine;hydrochloride |
| SMILES | C=CC[C@H](c1ccc(C(F)(F)F)c(Cl)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H18ClF3N2.ClH/c1-2-3-14(21-8-6-20-7-9-21)11-4-5-12(13(16)10-11)15(17,18)19;/h2,4-5,10,14,20H,1,3,6-9H2;1H/t14-;/m1./s1 |
| InChIKey | IUVCOBCZQIWJBH-PFEQFJNWSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|