C15H20Cl3F3N2O — CID 171292097
1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-enyl]piperazine;dihydrochloride (PubChem CID 171292097) has the molecular formula C15H20Cl3F3N2O and a molecular weight of 407.69 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292097 |
| Molecular Formula | C15H20Cl3F3N2O |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@H](c1ccc(OC(F)(F)F)c(Cl)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H18ClF3N2O.2ClH/c1-2-3-13(21-8-6-20-7-9-21)11-4-5-14(12(16)10-11)22-15(17,18)19;;/h2,4-5,10,13,20H,1,3,6-9H2;2*1H/t13-;;/m1../s1 |
| InChIKey | CMLNSBIRQDRLTJ-FFXKMJQXSA-N |
| XLogP | 4.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|