C13H16Cl2F4N2O — CID 171181992
1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-fluoroethyl]piperazine;hydrochloride (PubChem CID 171181992) has the molecular formula C13H16Cl2F4N2O and a molecular weight of 363.18 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-fluoroethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-fluoroethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181992 |
| Molecular Formula | C13H16Cl2F4N2O |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-fluoroethyl]piperazine;hydrochloride |
| SMILES | Cl.FC[C@H](c1ccc(OC(F)(F)F)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF4N2O.ClH/c14-10-7-9(1-2-12(10)21-13(16,17)18)11(8-15)20-5-3-19-4-6-20;/h1-2,7,11,19H,3-6,8H2;1H/t11-;/m1./s1 |
| InChIKey | JBRCBXJHJNTWNM-RFVHGSKJSA-N |
| XLogP | 3.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |