C16H22ClF3N2O — CID 171165767
1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-methylbutyl]piperazine (PubChem CID 171165767) has the molecular formula C16H22ClF3N2O and a molecular weight of 350.81 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171165767 |
| Molecular Formula | C16H22ClF3N2O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-methylbutyl]piperazine |
| SMILES | CC(C)C[C@@H](c1ccc(OC(F)(F)F)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C16H22ClF3N2O/c1-11(2)9-14(22-7-5-21-6-8-22)12-3-4-15(13(17)10-12)23-16(18,19)20/h3-4,10-11,14,21H,5-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | BPVOBIRFSBYOKD-AWEZNQCLSA-N |
| XLogP | 4.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |