C17H25Cl2F3N2O — CID 171170981
1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride (PubChem CID 171170981) has the molecular formula C17H25Cl2F3N2O and a molecular weight of 401.30 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170981 |
| Molecular Formula | C17H25Cl2F3N2O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]hexyl]piperazine;hydrochloride |
| SMILES | CCCCC[C@H](c1ccc(OC(F)(F)F)c(Cl)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H24ClF3N2O.ClH/c1-2-3-4-5-15(23-10-8-22-9-11-23)13-6-7-16(14(18)12-13)24-17(19,20)21;/h6-7,12,15,22H,2-5,8-11H2,1H3;1H/t15-;/m1./s1 |
| InChIKey | PWKJAOMFSVKBLV-XFULWGLBSA-N |
| XLogP | 5.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|