C17H29Cl3N2 — CID 171307770
1-[(1R)-1-(3-chloro-4-methylphenyl)hexyl]piperazine;dihydrochloride (PubChem CID 171307770) has the molecular formula C17H29Cl3N2 and a molecular weight of 367.79 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chloro-4-methylphenyl)hexyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-chloro-4-methylphenyl)hexyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171307770 |
| Molecular Formula | C17H29Cl3N2 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-[(1R)-1-(3-chloro-4-methylphenyl)hexyl]piperazine;dihydrochloride |
| SMILES | CCCCC[C@H](c1ccc(C)c(Cl)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H27ClN2.2ClH/c1-3-4-5-6-17(20-11-9-19-10-12-20)15-8-7-14(2)16(18)13-15;;/h7-8,13,17,19H,3-6,9-12H2,1-2H3;2*1H/t17-;;/m1../s1 |
| InChIKey | WIXZRITUIJEVCA-ZEECNFPPSA-N |
| XLogP | 5.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|