C16H24Br2N2 — CID 171309713
1-[(1S)-1-(3,4-dibromophenyl)hexyl]piperazine (PubChem CID 171309713) has the molecular formula C16H24Br2N2 and a molecular weight of 404.19 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dibromophenyl)hexyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,4-dibromophenyl)hexyl]piperazine |
|---|---|
| PubChem CID | 171309713 |
| Molecular Formula | C16H24Br2N2 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 1-[(1S)-1-(3,4-dibromophenyl)hexyl]piperazine |
| SMILES | CCCCC[C@@H](c1ccc(Br)c(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C16H24Br2N2/c1-2-3-4-5-16(20-10-8-19-9-11-20)13-6-7-14(17)15(18)12-13/h6-7,12,16,19H,2-5,8-11H2,1H3/t16-/m0/s1 |
| InChIKey | XIKSRCPAXRKGGE-INIZCTEOSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|