C12H16Br2N2O — CID 171183258
(2S)-2-(3,4-dibromophenyl)-2-piperazin-1-ylethanol (PubChem CID 171183258) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is (2S)-2-(3,4-dibromophenyl)-2-piperazin-1-ylethanol.
| Compound Name | (2S)-2-(3,4-dibromophenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 171183258 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | (2S)-2-(3,4-dibromophenyl)-2-piperazin-1-ylethanol |
| SMILES | OC[C@H](c1ccc(Br)c(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H16Br2N2O/c13-10-2-1-9(7-11(10)14)12(8-17)16-5-3-15-4-6-16/h1-2,7,12,15,17H,3-6,8H2/t12-/m1/s1 |
| InChIKey | CJUHAOUBKQBVIN-GFCCVEGCSA-N |
| XLogP | 2.15 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |