C12H17Br2Cl2FN2 — CID 171296260
1-[(1S)-1-(3,4-dibromophenyl)-2-fluoroethyl]piperazine;dihydrochloride (PubChem CID 171296260) has the molecular formula C12H17Br2Cl2FN2 and a molecular weight of 438.99 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dibromophenyl)-2-fluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(3,4-dibromophenyl)-2-fluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171296260 |
| Molecular Formula | C12H17Br2Cl2FN2 |
| Molecular Weight | 438.99 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | 1-[(1S)-1-(3,4-dibromophenyl)-2-fluoroethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC[C@H](c1ccc(Br)c(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H15Br2FN2.2ClH/c13-10-2-1-9(7-11(10)14)12(8-15)17-5-3-16-4-6-17;;/h1-2,7,12,16H,3-6,8H2;2*1H/t12-;;/m1../s1 |
| InChIKey | WODBOMJLEASUAZ-CURYUGHLSA-N |
| XLogP | 3.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |